C10H12ClN3O3S — CID 154701976
(2R)-2-(4-amino-7-chloro-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl)propan-1-ol (PubChem CID 154701976) has the molecular formula C10H12ClN3O3S and a molecular weight of 289.74 g/mol. Its IUPAC name is (2R)-2-(4-amino-7-chloro-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl)propan-1-ol.
| Compound Name | (2R)-2-(4-amino-7-chloro-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 154701976 |
| Molecular Formula | C10H12ClN3O3S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | (2R)-2-(4-amino-7-chloro-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl)propan-1-ol |
| SMILES | C[C@@H](CO)C1=NS(=O)(=O)c2cc(Cl)ccc2N1N |
| InChI | InChI=1S/C10H12ClN3O3S/c1-6(5-15)10-13-18(16,17)9-4-7(11)2-3-8(9)14(10)12/h2-4,6,15H,5,12H2,1H3/t6-/m0/s1 |
| InChIKey | MWZYSSPAQSUZRK-LURJTMIESA-N |
| XLogP | 0.75 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|