C15H20ClN3O2S — CID 150513883
7-chloro-3-[(1R)-1-cyclohexylethyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-amine (PubChem CID 150513883) has the molecular formula C15H20ClN3O2S and a molecular weight of 341.86 g/mol. Its IUPAC name is 7-chloro-3-[(1R)-1-cyclohexylethyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-amine.
| Compound Name | 7-chloro-3-[(1R)-1-cyclohexylethyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-amine |
|---|---|
| PubChem CID | 150513883 |
| Molecular Formula | C15H20ClN3O2S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 7-chloro-3-[(1R)-1-cyclohexylethyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-amine |
| SMILES | C[C@@H](C1=NS(=O)(=O)c2cc(Cl)ccc2N1N)C1CCCCC1 |
| InChI | InChI=1S/C15H20ClN3O2S/c1-10(11-5-3-2-4-6-11)15-18-22(20,21)14-9-12(16)7-8-13(14)19(15)17/h7-11H,2-6,17H2,1H3/t10-/m1/s1 |
| InChIKey | IAKNZHNVOSVZRL-SNVBAGLBSA-N |
| XLogP | 3.34 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|