C11H14ClN3O2S2 — CID 174407244
6-chloro-3-cyclohexyl-1,1-dioxothieno[3,2-e][1,2,4]thiadiazin-4-amine (PubChem CID 174407244) has the molecular formula C11H14ClN3O2S2 and a molecular weight of 319.84 g/mol. Its IUPAC name is 6-chloro-3-cyclohexyl-1,1-dioxothieno[3,2-e][1,2,4]thiadiazin-4-amine.
| Compound Name | 6-chloro-3-cyclohexyl-1,1-dioxothieno[3,2-e][1,2,4]thiadiazin-4-amine |
|---|---|
| PubChem CID | 174407244 |
| Molecular Formula | C11H14ClN3O2S2 |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 6-chloro-3-cyclohexyl-1,1-dioxothieno[3,2-e][1,2,4]thiadiazin-4-amine |
| SMILES | NN1C(C2CCCCC2)=NS(=O)(=O)c2sc(Cl)cc21 |
| InChI | InChI=1S/C11H14ClN3O2S2/c12-9-6-8-11(18-9)19(16,17)14-10(15(8)13)7-4-2-1-3-5-7/h6-7H,1-5,13H2 |
| InChIKey | XVOJULCVOZLIKR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|