C10H13Cl2NO2S2 — CID 104518425
(2,5-dichlorothiophen-3-yl)-(1,1-dioxothian-2-yl)methanamine (PubChem CID 104518425) has the molecular formula C10H13Cl2NO2S2 and a molecular weight of 314.26 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-(1,1-dioxothian-2-yl)methanamine.
| Compound Name | (2,5-dichlorothiophen-3-yl)-(1,1-dioxothian-2-yl)methanamine |
|---|---|
| PubChem CID | 104518425 |
| Molecular Formula | C10H13Cl2NO2S2 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-(1,1-dioxothian-2-yl)methanamine |
| SMILES | NC(c1cc(Cl)sc1Cl)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C10H13Cl2NO2S2/c11-8-5-6(10(12)16-8)9(13)7-3-1-2-4-17(7,14)15/h5,7,9H,1-4,13H2 |
| InChIKey | GNYGKXWDGVQBIK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |