C14H20ClN3O2S — CID 172855810
7-chloro-3-(4-methylhexan-2-yl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-amine (PubChem CID 172855810) has the molecular formula C14H20ClN3O2S and a molecular weight of 329.85 g/mol. Its IUPAC name is 7-chloro-3-(4-methylhexan-2-yl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-amine.
| Compound Name | 7-chloro-3-(4-methylhexan-2-yl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-amine |
|---|---|
| PubChem CID | 172855810 |
| Molecular Formula | C14H20ClN3O2S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 7-chloro-3-(4-methylhexan-2-yl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-amine |
| SMILES | CCC(C)CC(C)C1=NS(=O)(=O)c2cc(Cl)ccc2N1N |
| InChI | InChI=1S/C14H20ClN3O2S/c1-4-9(2)7-10(3)14-17-21(19,20)13-8-11(15)5-6-12(13)18(14)16/h5-6,8-10H,4,7,16H2,1-3H3 |
| InChIKey | YRODFTJCOMCDHY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|