C9H8ClN2O6PS-2 — CID 140762132
(7-chloro-3-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl phosphate (PubChem CID 140762132) has the molecular formula C9H8ClN2O6PS-2 and a molecular weight of 338.67 g/mol. Its IUPAC name is (7-chloro-3-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl phosphate.
| Compound Name | (7-chloro-3-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl phosphate |
|---|---|
| PubChem CID | 140762132 |
| Molecular Formula | C9H8ClN2O6PS-2 |
| Molecular Weight | 338.67 g/mol |
| Exact Mass | 337.95 |
| IUPAC Name | (7-chloro-3-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl phosphate |
| SMILES | CC1=NS(=O)(=O)c2cc(Cl)ccc2N1COP(=O)([O-])[O-] |
| InChI | InChI=1S/C9H10ClN2O6PS/c1-6-11-20(16,17)9-4-7(10)2-3-8(9)12(6)5-18-19(13,14)15/h2-4H,5H2,1H3,(H2,13,14,15)/p-2 |
| InChIKey | WBFWTWNBBWNUQM-UHFFFAOYSA-L |
| XLogP | 0.07 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.67 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|