C11H22ClN2O4P — CID 70470680
(4-chlorophenyl)methyl phosphate;bis(dimethylazanium) (PubChem CID 70470680) has the molecular formula C11H22ClN2O4P and a molecular weight of 312.73 g/mol. Its IUPAC name is (4-chlorophenyl)methyl phosphate;bis(dimethylazanium).
| Compound Name | (4-chlorophenyl)methyl phosphate;bis(dimethylazanium) |
|---|---|
| PubChem CID | 70470680 |
| Molecular Formula | C11H22ClN2O4P |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (4-chlorophenyl)methyl phosphate;bis(dimethylazanium) |
| SMILES | C[NH2+]C.C[NH2+]C.O=P([O-])([O-])OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H8ClO4P.2C2H7N/c8-7-3-1-6(2-4-7)5-12-13(9,10)11;2*1-3-2/h1-4H,5H2,(H2,9,10,11);2*3H,1-2H3 |
| InChIKey | AHTLACLBNIBQIY-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|