C20H25Cl2O6P — CID 21023152
bis[1-[(4-chlorophenyl)methoxy]propan-2-yl] hydrogen phosphate (PubChem CID 21023152) has the molecular formula C20H25Cl2O6P and a molecular weight of 463.29 g/mol. Its IUPAC name is bis[1-[(4-chlorophenyl)methoxy]propan-2-yl] hydrogen phosphate.
| Compound Name | bis[1-[(4-chlorophenyl)methoxy]propan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 21023152 |
| Molecular Formula | C20H25Cl2O6P |
| Molecular Weight | 463.29 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | bis[1-[(4-chlorophenyl)methoxy]propan-2-yl] hydrogen phosphate |
| SMILES | CC(COCc1ccc(Cl)cc1)OP(=O)(O)OC(C)COCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H25Cl2O6P/c1-15(11-25-13-17-3-7-19(21)8-4-17)27-29(23,24)28-16(2)12-26-14-18-5-9-20(22)10-6-18/h3-10,15-16H,11-14H2,1-2H3,(H,23,24) |
| InChIKey | PDXMCXIEGZMTAK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.29 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|