C24H26ClN5O3S — CID 100770757
N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-3-methyl-1,1-dioxo-4-propyl-1λ6,2,4-benzothiadiazine-7-carboxamide (PubChem CID 100770757) has the molecular formula C24H26ClN5O3S and a molecular weight of 500.02 g/mol. Its IUPAC name is N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-3-methyl-1,1-dioxo-4-propyl-1λ6,2,4-benzothiadiazine-7-carboxamide.
| Compound Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-3-methyl-1,1-dioxo-4-propyl-1λ6,2,4-benzothiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 100770757 |
| Molecular Formula | C24H26ClN5O3S |
| Molecular Weight | 500.02 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-3-methyl-1,1-dioxo-4-propyl-1λ6,2,4-benzothiadiazine-7-carboxamide |
| SMILES | CCCN1C(C)=NS(=O)(=O)c2cc(C(=O)NCCCNc3ccnc4cc(Cl)ccc34)ccc21 |
| InChI | InChI=1S/C24H26ClN5O3S/c1-3-13-30-16(2)29-34(32,33)23-14-17(5-8-22(23)30)24(31)28-11-4-10-26-20-9-12-27-21-15-18(25)6-7-19(20)21/h5-9,12,14-15H,3-4,10-11,13H2,1-2H3,(H,26,27)(H,28,31) |
| InChIKey | MRJZDKUFZXSTNB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.02 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|