C9H8ClNO2S — CID 158107838
7-chloro-3-methyl-4H-1λ6,2-benzothiazine 1,1-dioxide (PubChem CID 158107838) has the molecular formula C9H8ClNO2S and a molecular weight of 229.69 g/mol. Its IUPAC name is 7-chloro-3-methyl-4H-1λ6,2-benzothiazine 1,1-dioxide.
| Compound Name | 7-chloro-3-methyl-4H-1λ6,2-benzothiazine 1,1-dioxide |
|---|---|
| PubChem CID | 158107838 |
| Molecular Formula | C9H8ClNO2S |
| Molecular Weight | 229.69 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 7-chloro-3-methyl-4H-1λ6,2-benzothiazine 1,1-dioxide |
| SMILES | CC1=NS(=O)(=O)c2cc(Cl)ccc2C1 |
| InChI | InChI=1S/C9H8ClNO2S/c1-6-4-7-2-3-8(10)5-9(7)14(12,13)11-6/h2-3,5H,4H2,1H3 |
| InChIKey | VWQIXXFSXBTBFJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.69 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |