About azane;3-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene
azane;3-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene (PubChem CID 66993056) has the molecular formula C7H8ClN
and a molecular weight of 141.60 g/mol. Its IUPAC name is azane;3-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene.
Analyze azane;3-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene?
The IUPAC name of azane;3-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene (CID 66993056) is azane;3-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene.
What is the SMILES notation for azane;3-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene?
The canonical SMILES for azane;3-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene is Clc1ccc2c(c1)C2.N.
What is the InChIKey of azane;3-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene?
The InChIKey is OWLVCOILSYAVQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl.H3N/c8-7-2-1-5-3-6(5)4-7;/h1-2,4H,3H2;1H3.
What are the key properties of azane;3-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene?
azane;3-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene has a molecular weight of 141.60 g/mol, XLogP of 2.41, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene is sourced from PubChem (CID 66993056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).