C17H20ClN — CID 142002514
13-chloro-6-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;ethane (PubChem CID 142002514) has the molecular formula C17H20ClN and a molecular weight of 273.81 g/mol. Its IUPAC name is 13-chloro-6-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;ethane.
| Compound Name | 13-chloro-6-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;ethane |
|---|---|
| PubChem CID | 142002514 |
| Molecular Formula | C17H20ClN |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 13-chloro-6-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;ethane |
| SMILES | CC.Cc1cnc2c(c1)CCc1cc(Cl)ccc1C2 |
| InChI | InChI=1S/C15H14ClN.C2H6/c1-10-6-13-3-2-11-7-14(16)5-4-12(11)8-15(13)17-9-10;1-2/h4-7,9H,2-3,8H2,1H3;1-2H3 |
| InChIKey | NCEYQNLQONGJFR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |