C13H18N2O — CID 90345822
(E)-N-methoxy-3-methyl-6,8,9,10-tetrahydro-5H-cycloocta[b]pyridin-7-imine (PubChem CID 90345822) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is (E)-N-methoxy-3-methyl-6,8,9,10-tetrahydro-5H-cycloocta[b]pyridin-7-imine.
| Compound Name | (E)-N-methoxy-3-methyl-6,8,9,10-tetrahydro-5H-cycloocta[b]pyridin-7-imine |
|---|---|
| PubChem CID | 90345822 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (E)-N-methoxy-3-methyl-6,8,9,10-tetrahydro-5H-cycloocta[b]pyridin-7-imine |
| SMILES | CO/N=C1\CCCc2ncc(C)cc2CC1 |
| InChI | InChI=1S/C13H18N2O/c1-10-8-11-6-7-12(15-16-2)4-3-5-13(11)14-9-10/h8-9H,3-7H2,1-2H3/b15-12+ |
| InChIKey | DLOANFQUESTDPF-NTCAYCPXSA-N |
| XLogP | 2.66 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|