C10H9ClO — CID 4065216
7-chloro-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 4065216) has the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. Its IUPAC name is 7-chloro-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 7-chloro-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 4065216 |
| Molecular Formula | C10H9ClO |
| Molecular Weight | 180.63 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 7-chloro-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | O=C1CCc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C10H9ClO/c11-9-3-1-7-2-4-10(12)6-8(7)5-9/h1,3,5H,2,4,6H2 |
| InChIKey | CSIHHNSBJNDXNO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.63 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |