C10H9FO2 — CID 131343881
6-fluoro-5-hydroxy-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 131343881) has the molecular formula C10H9FO2 and a molecular weight of 180.18 g/mol. Its IUPAC name is 6-fluoro-5-hydroxy-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 6-fluoro-5-hydroxy-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 131343881 |
| Molecular Formula | C10H9FO2 |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 6-fluoro-5-hydroxy-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | O=C1CCc2c(ccc(F)c2O)C1 |
| InChI | InChI=1S/C10H9FO2/c11-9-4-1-6-5-7(12)2-3-8(6)10(9)13/h1,4,13H,2-3,5H2 |
| InChIKey | YGYQOKBHOZYKEA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |