About 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-ol
3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-ol (PubChem CID 22102252) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-ol.
Analyze 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-ol?
The IUPAC name of 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-ol (CID 22102252) is 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-ol.
What is the SMILES notation for 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-ol?
The canonical SMILES for 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-ol is Cc1ccc2c(c1O)CC2.
What is the InChIKey of 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-ol?
The InChIKey is BQWFDJVSNGQHTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-6-2-3-7-4-5-8(7)9(6)10/h2-3,10H,4-5H2,1H3.
What are the key properties of 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-ol?
3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-ol has a molecular weight of 134.18 g/mol, XLogP of 1.80, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-ol is sourced from PubChem (CID 22102252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).