About 5-hydroxy-6-methyl-3,4-dihydro-1H-quinolin-2-one
5-hydroxy-6-methyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 10877685) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 5-hydroxy-6-methyl-3,4-dihydro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-6-methyl-3,4-dihydro-1H-quinolin-2-one |
| PubChem CID | 10877685 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 5-hydroxy-6-methyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1ccc2c(c1O)CCC(=O)N2 |
| InChI | InChI=1S/C10H11NO2/c1-6-2-4-8-7(10(6)13)3-5-9(12)11-8/h2,4,13H,3,5H2,1H3,(H,11,12) |
| InChIKey | LDMHLWVMDQGTCA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-hydroxy-6-methyl-3,4-dihydro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-6-methyl-3,4-dihydro-1H-quinolin-2-one?
The IUPAC name of 5-hydroxy-6-methyl-3,4-dihydro-1H-quinolin-2-one (CID 10877685) is 5-hydroxy-6-methyl-3,4-dihydro-1H-quinolin-2-one.
What is the SMILES notation for 5-hydroxy-6-methyl-3,4-dihydro-1H-quinolin-2-one?
The canonical SMILES for 5-hydroxy-6-methyl-3,4-dihydro-1H-quinolin-2-one is Cc1ccc2c(c1O)CCC(=O)N2.
What is the InChIKey of 5-hydroxy-6-methyl-3,4-dihydro-1H-quinolin-2-one?
The InChIKey is LDMHLWVMDQGTCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-6-2-4-8-7(10(6)13)3-5-9(12)11-8/h2,4,13H,3,5H2,1H3,(H,11,12).
What are the key properties of 5-hydroxy-6-methyl-3,4-dihydro-1H-quinolin-2-one?
5-hydroxy-6-methyl-3,4-dihydro-1H-quinolin-2-one has a molecular weight of 177.20 g/mol, XLogP of 1.59, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-6-methyl-3,4-dihydro-1H-quinolin-2-one is sourced from PubChem (CID 10877685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).