C11H13NO4 — CID 22095461
6-hydroxy-5,7-bis(hydroxymethyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 22095461) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 6-hydroxy-5,7-bis(hydroxymethyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-hydroxy-5,7-bis(hydroxymethyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 22095461 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 6-hydroxy-5,7-bis(hydroxymethyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2c(cc(CO)c(O)c2CO)N1 |
| InChI | InChI=1S/C11H13NO4/c13-4-6-3-9-7(1-2-10(15)12-9)8(5-14)11(6)16/h3,13-14,16H,1-2,4-5H2,(H,12,15) |
| InChIKey | SJUVFTMYAZSSSA-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|