C8H7IN2O2 — CID 169149189
7-iodo-1,3,4,6-tetrahydro-1,6-naphthyridine-2,5-dione (PubChem CID 169149189) has the molecular formula C8H7IN2O2 and a molecular weight of 290.06 g/mol. Its IUPAC name is 7-iodo-1,3,4,6-tetrahydro-1,6-naphthyridine-2,5-dione.
| Compound Name | 7-iodo-1,3,4,6-tetrahydro-1,6-naphthyridine-2,5-dione |
|---|---|
| PubChem CID | 169149189 |
| Molecular Formula | C8H7IN2O2 |
| Molecular Weight | 290.06 g/mol |
| Exact Mass | 289.96 |
| IUPAC Name | 7-iodo-1,3,4,6-tetrahydro-1,6-naphthyridine-2,5-dione |
| SMILES | O=C1CCc2c(cc(I)[nH]c2=O)N1 |
| InChI | InChI=1S/C8H7IN2O2/c9-6-3-5-4(8(13)11-6)1-2-7(12)10-5/h3H,1-2H2,(H,10,12)(H,11,13) |
| InChIKey | XAIWHBMAWUOIRX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.06 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|