C10H7ClINO2 — CID 58476599
8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione (PubChem CID 58476599) has the molecular formula C10H7ClINO2 and a molecular weight of 335.53 g/mol. Its IUPAC name is 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione.
| Compound Name | 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione |
|---|---|
| PubChem CID | 58476599 |
| Molecular Formula | C10H7ClINO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 334.92 |
| IUPAC Name | 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione |
| SMILES | O=C1CCC(=O)c2cc(I)c(Cl)cc2N1 |
| InChI | InChI=1S/C10H7ClINO2/c11-6-4-8-5(3-7(6)12)9(14)1-2-10(15)13-8/h3-4H,1-2H2,(H,13,15) |
| InChIKey | IONNIIWTRIKNCT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|