About 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione
8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione (PubChem CID 58476599) has the molecular formula C10H7ClINO2
and a molecular weight of 335.53 g/mol. Its IUPAC name is 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione.
Molecular Properties
| Compound Name | 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione |
| PubChem CID | 58476599 |
| Molecular Formula | C10H7ClINO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 334.92 |
| IUPAC Name | 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione |
| SMILES | O=C1CCC(=O)c2cc(I)c(Cl)cc2N1 |
| InChI | InChI=1S/C10H7ClINO2/c11-6-4-8-5(3-7(6)12)9(14)1-2-10(15)13-8/h3-4H,1-2H2,(H,13,15) |
| InChIKey | IONNIIWTRIKNCT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione?
The IUPAC name of 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione (CID 58476599) is 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione.
What is the SMILES notation for 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione?
The canonical SMILES for 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione is O=C1CCC(=O)c2cc(I)c(Cl)cc2N1.
What is the InChIKey of 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione?
The InChIKey is IONNIIWTRIKNCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClINO2/c11-6-4-8-5(3-7(6)12)9(14)1-2-10(15)13-8/h3-4H,1-2H2,(H,13,15).
What are the key properties of 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione?
8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione has a molecular weight of 335.53 g/mol, XLogP of 2.86, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-7-iodo-3,4-dihydro-1H-1-benzazepine-2,5-dione is sourced from PubChem (CID 58476599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).