C9H8ClNO2 — CID 14268518
8-chloro-6-hydroxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 14268518) has the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. Its IUPAC name is 8-chloro-6-hydroxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 8-chloro-6-hydroxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 14268518 |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 8-chloro-6-hydroxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(O)cc(Cl)c2N1 |
| InChI | InChI=1S/C9H8ClNO2/c10-7-4-6(12)3-5-1-2-8(13)11-9(5)7/h3-4,12H,1-2H2,(H,11,13) |
| InChIKey | PHJNAGMRWBNGIW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|