C12H15ClN2O — CID 82190791
6-(2-aminopropyl)-8-chloro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 82190791) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 6-(2-aminopropyl)-8-chloro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(2-aminopropyl)-8-chloro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 82190791 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 6-(2-aminopropyl)-8-chloro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CC(N)Cc1cc(Cl)c2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C12H15ClN2O/c1-7(14)4-8-5-9-2-3-11(16)15-12(9)10(13)6-8/h5-7H,2-4,14H2,1H3,(H,15,16) |
| InChIKey | KZXGOTNZEHTPLP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |