C10H7ClN2O — CID 84779277
2-(7-chloro-2-oxo-1,3-dihydroindol-5-yl)acetonitrile (PubChem CID 84779277) has the molecular formula C10H7ClN2O and a molecular weight of 206.63 g/mol. Its IUPAC name is 2-(7-chloro-2-oxo-1,3-dihydroindol-5-yl)acetonitrile.
| Compound Name | 2-(7-chloro-2-oxo-1,3-dihydroindol-5-yl)acetonitrile |
|---|---|
| PubChem CID | 84779277 |
| Molecular Formula | C10H7ClN2O |
| Molecular Weight | 206.63 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 2-(7-chloro-2-oxo-1,3-dihydroindol-5-yl)acetonitrile |
| SMILES | N#CCc1cc(Cl)c2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C10H7ClN2O/c11-8-4-6(1-2-12)3-7-5-9(14)13-10(7)8/h3-4H,1,5H2,(H,13,14) |
| InChIKey | GXZCDOBFSAOAJK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.63 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |