C8H4Cl2IN — CID 134125339
2-(3,5-dichloro-4-iodophenyl)acetonitrile (PubChem CID 134125339) has the molecular formula C8H4Cl2IN and a molecular weight of 311.94 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-iodophenyl)acetonitrile.
| Compound Name | 2-(3,5-dichloro-4-iodophenyl)acetonitrile |
|---|---|
| PubChem CID | 134125339 |
| Molecular Formula | C8H4Cl2IN |
| Molecular Weight | 311.94 g/mol |
| Exact Mass | 310.88 |
| IUPAC Name | 2-(3,5-dichloro-4-iodophenyl)acetonitrile |
| SMILES | N#CCc1cc(Cl)c(I)c(Cl)c1 |
| InChI | InChI=1S/C8H4Cl2IN/c9-6-3-5(1-2-12)4-7(10)8(6)11/h3-4H,1H2 |
| InChIKey | USCCPRLPYQTKFG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.94 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|