C19H8Cl6N2 — CID 134637823
2-[2,6-bis(3,4,5-trichlorophenyl)-4-pyridinyl]acetonitrile (PubChem CID 134637823) has the molecular formula C19H8Cl6N2 and a molecular weight of 477.01 g/mol. Its IUPAC name is 2-[2,6-bis(3,4,5-trichlorophenyl)-4-pyridinyl]acetonitrile.
| Compound Name | 2-[2,6-bis(3,4,5-trichlorophenyl)-4-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 134637823 |
| Molecular Formula | C19H8Cl6N2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 473.88 |
| IUPAC Name | 2-[2,6-bis(3,4,5-trichlorophenyl)-4-pyridinyl]acetonitrile |
| SMILES | N#CCc1cc(-c2cc(Cl)c(Cl)c(Cl)c2)nc(-c2cc(Cl)c(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H8Cl6N2/c20-12-5-10(6-13(21)18(12)24)16-3-9(1-2-26)4-17(27-16)11-7-14(22)19(25)15(23)8-11/h3-8H,1H2 |
| InChIKey | ADYPYPQJRDDUIQ-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|