C13H8Cl3N3 — CID 134624002
2-[3-amino-2-(3,4,5-trichlorophenyl)-4-pyridinyl]acetonitrile (PubChem CID 134624002) has the molecular formula C13H8Cl3N3 and a molecular weight of 312.59 g/mol. Its IUPAC name is 2-[3-amino-2-(3,4,5-trichlorophenyl)-4-pyridinyl]acetonitrile.
| Compound Name | 2-[3-amino-2-(3,4,5-trichlorophenyl)-4-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 134624002 |
| Molecular Formula | C13H8Cl3N3 |
| Molecular Weight | 312.59 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 2-[3-amino-2-(3,4,5-trichlorophenyl)-4-pyridinyl]acetonitrile |
| SMILES | N#CCc1ccnc(-c2cc(Cl)c(Cl)c(Cl)c2)c1N |
| InChI | InChI=1S/C13H8Cl3N3/c14-9-5-8(6-10(15)11(9)16)13-12(18)7(1-3-17)2-4-19-13/h2,4-6H,1,18H2 |
| InChIKey | FKQNYZFBQRNVGQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|