C13H7Cl3N2 — CID 118847553
2-[2-(2,4,6-trichlorophenyl)-4-pyridinyl]acetonitrile (PubChem CID 118847553) has the molecular formula C13H7Cl3N2 and a molecular weight of 297.57 g/mol. Its IUPAC name is 2-[2-(2,4,6-trichlorophenyl)-4-pyridinyl]acetonitrile.
| Compound Name | 2-[2-(2,4,6-trichlorophenyl)-4-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118847553 |
| Molecular Formula | C13H7Cl3N2 |
| Molecular Weight | 297.57 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | 2-[2-(2,4,6-trichlorophenyl)-4-pyridinyl]acetonitrile |
| SMILES | N#CCc1ccnc(-c2c(Cl)cc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H7Cl3N2/c14-9-6-10(15)13(11(16)7-9)12-5-8(1-3-17)2-4-18-12/h2,4-7H,1H2 |
| InChIKey | BZYSTFYICQZQKJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |