C14H5Cl5FN — CID 134631147
2-[4-fluoro-3-(2,3,4,5,6-pentachlorophenyl)phenyl]acetonitrile (PubChem CID 134631147) has the molecular formula C14H5Cl5FN and a molecular weight of 383.46 g/mol. Its IUPAC name is 2-[4-fluoro-3-(2,3,4,5,6-pentachlorophenyl)phenyl]acetonitrile.
| Compound Name | 2-[4-fluoro-3-(2,3,4,5,6-pentachlorophenyl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 134631147 |
| Molecular Formula | C14H5Cl5FN |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 380.88 |
| IUPAC Name | 2-[4-fluoro-3-(2,3,4,5,6-pentachlorophenyl)phenyl]acetonitrile |
| SMILES | N#CCc1ccc(F)c(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c1 |
| InChI | InChI=1S/C14H5Cl5FN/c15-10-9(11(16)13(18)14(19)12(10)17)7-5-6(3-4-21)1-2-8(7)20/h1-2,5H,3H2 |
| InChIKey | YBQVTLOHPFYWKH-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|