C8H6INO2 — CID 15133322
2-(3,4-dihydroxy-5-iodophenyl)acetonitrile (PubChem CID 15133322) has the molecular formula C8H6INO2 and a molecular weight of 275.05 g/mol. Its IUPAC name is 2-(3,4-dihydroxy-5-iodophenyl)acetonitrile.
| Compound Name | 2-(3,4-dihydroxy-5-iodophenyl)acetonitrile |
|---|---|
| PubChem CID | 15133322 |
| Molecular Formula | C8H6INO2 |
| Molecular Weight | 275.05 g/mol |
| Exact Mass | 274.94 |
| IUPAC Name | 2-(3,4-dihydroxy-5-iodophenyl)acetonitrile |
| SMILES | N#CCc1cc(O)c(O)c(I)c1 |
| InChI | InChI=1S/C8H6INO2/c9-6-3-5(1-2-10)4-7(11)8(6)12/h3-4,11-12H,1H2 |
| InChIKey | TWGVWGLAAMWVCU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.05 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|