C9H7I2NO — CID 90143526
2-(3,5-diiodo-4-methoxyphenyl)acetonitrile (PubChem CID 90143526) has the molecular formula C9H7I2NO and a molecular weight of 398.97 g/mol. Its IUPAC name is 2-(3,5-diiodo-4-methoxyphenyl)acetonitrile.
| Compound Name | 2-(3,5-diiodo-4-methoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 90143526 |
| Molecular Formula | C9H7I2NO |
| Molecular Weight | 398.97 g/mol |
| Exact Mass | 398.86 |
| IUPAC Name | 2-(3,5-diiodo-4-methoxyphenyl)acetonitrile |
| SMILES | COc1c(I)cc(CC#N)cc1I |
| InChI | InChI=1S/C9H7I2NO/c1-13-9-7(10)4-6(2-3-12)5-8(9)11/h4-5H,2H2,1H3 |
| InChIKey | IEHNMVXXVLLANW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.97 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|