C13H7Cl3N2O — CID 122655698
7-chloro-5-(3,5-dichloro-4-pyridinyl)-1,3-dihydroindol-2-one (PubChem CID 122655698) has the molecular formula C13H7Cl3N2O and a molecular weight of 313.57 g/mol. Its IUPAC name is 7-chloro-5-(3,5-dichloro-4-pyridinyl)-1,3-dihydroindol-2-one.
| Compound Name | 7-chloro-5-(3,5-dichloro-4-pyridinyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 122655698 |
| Molecular Formula | C13H7Cl3N2O |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | 7-chloro-5-(3,5-dichloro-4-pyridinyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(-c3c(Cl)cncc3Cl)cc(Cl)c2N1 |
| InChI | InChI=1S/C13H7Cl3N2O/c14-8-2-6(1-7-3-11(19)18-13(7)8)12-9(15)4-17-5-10(12)16/h1-2,4-5H,3H2,(H,18,19) |
| InChIKey | KFFVWKKOWNPXME-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |