C14H17ClN2O — CID 117416260
5-(1-aminocyclohexyl)-7-chloro-1,3-dihydroindol-2-one (PubChem CID 117416260) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 5-(1-aminocyclohexyl)-7-chloro-1,3-dihydroindol-2-one.
| Compound Name | 5-(1-aminocyclohexyl)-7-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 117416260 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 5-(1-aminocyclohexyl)-7-chloro-1,3-dihydroindol-2-one |
| SMILES | NC1(c2cc(Cl)c3c(c2)CC(=O)N3)CCCCC1 |
| InChI | InChI=1S/C14H17ClN2O/c15-11-8-10(14(16)4-2-1-3-5-14)6-9-7-12(18)17-13(9)11/h6,8H,1-5,7,16H2,(H,17,18) |
| InChIKey | PHBPMULIQUBHHV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |