About 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one
7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one (PubChem CID 10749642) has the molecular formula C7H5ClN2O
and a molecular weight of 168.58 g/mol. Its IUPAC name is 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one.
Molecular Properties
| Compound Name | 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one |
| PubChem CID | 10749642 |
| Molecular Formula | C7H5ClN2O |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one |
| SMILES | O=C1Cc2ccnc(Cl)c2N1 |
| InChI | InChI=1S/C7H5ClN2O/c8-7-6-4(1-2-9-7)3-5(11)10-6/h1-2H,3H2,(H,10,11) |
| InChIKey | JHSXMNUYBFUKFP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one?
The IUPAC name of 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one (CID 10749642) is 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one.
What is the SMILES notation for 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one?
The canonical SMILES for 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one is O=C1Cc2ccnc(Cl)c2N1.
What is the InChIKey of 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one?
The InChIKey is JHSXMNUYBFUKFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O/c8-7-6-4(1-2-9-7)3-5(11)10-6/h1-2H,3H2,(H,10,11).
What are the key properties of 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one?
7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one has a molecular weight of 168.58 g/mol, XLogP of 1.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one is sourced from PubChem (CID 10749642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).