C7H5ClN2O — CID 10749642
7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one (PubChem CID 10749642) has the molecular formula C7H5ClN2O and a molecular weight of 168.58 g/mol. Its IUPAC name is 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one.
| Compound Name | 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one |
|---|---|
| PubChem CID | 10749642 |
| Molecular Formula | C7H5ClN2O |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 7-chloro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one |
| SMILES | O=C1Cc2ccnc(Cl)c2N1 |
| InChI | InChI=1S/C7H5ClN2O/c8-7-6-4(1-2-9-7)3-5(11)10-6/h1-2H,3H2,(H,10,11) |
| InChIKey | JHSXMNUYBFUKFP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|