C9H11ClN2 — CID 130067167
9-chloro-2,3,4,5-tetrahydro-1H-pyrido[3,4-b]azepine (PubChem CID 130067167) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is 9-chloro-2,3,4,5-tetrahydro-1H-pyrido[3,4-b]azepine.
| Compound Name | 9-chloro-2,3,4,5-tetrahydro-1H-pyrido[3,4-b]azepine |
|---|---|
| PubChem CID | 130067167 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 9-chloro-2,3,4,5-tetrahydro-1H-pyrido[3,4-b]azepine |
| SMILES | Clc1nccc2c1NCCCC2 |
| InChI | InChI=1S/C9H11ClN2/c10-9-8-7(4-6-12-9)3-1-2-5-11-8/h4,6,11H,1-3,5H2 |
| InChIKey | VLLMSBOFYYKZHT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|