C11H16N2 — CID 84655683
2,3,4,5-tetrahydro-1H-1-benzazepin-9-ylmethanamine (PubChem CID 84655683) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1H-1-benzazepin-9-ylmethanamine.
| Compound Name | 2,3,4,5-tetrahydro-1H-1-benzazepin-9-ylmethanamine |
|---|---|
| PubChem CID | 84655683 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2,3,4,5-tetrahydro-1H-1-benzazepin-9-ylmethanamine |
| SMILES | NCc1cccc2c1NCCCC2 |
| InChI | InChI=1S/C11H16N2/c12-8-10-6-3-5-9-4-1-2-7-13-11(9)10/h3,5-6,13H,1-2,4,7-8,12H2 |
| InChIKey | JXJWZSIQLOGSGY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |