C9H11NS — CID 71358239
1,2,3,4-tetrahydroquinoline-8-thiol (PubChem CID 71358239) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroquinoline-8-thiol.
| Compound Name | 1,2,3,4-tetrahydroquinoline-8-thiol |
|---|---|
| PubChem CID | 71358239 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 1,2,3,4-tetrahydroquinoline-8-thiol |
| SMILES | Sc1cccc2c1NCCC2 |
| InChI | InChI=1S/C9H11NS/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1,3,5,10-11H,2,4,6H2 |
| InChIKey | PBHWOBUIERAQKO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|