C14H22N2 — CID 80648821
N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)butan-2-amine (PubChem CID 80648821) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)butan-2-amine.
| Compound Name | N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)butan-2-amine |
|---|---|
| PubChem CID | 80648821 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)butan-2-amine |
| SMILES | CCC(C)NCc1cccc2c1NCCC2 |
| InChI | InChI=1S/C14H22N2/c1-3-11(2)16-10-13-7-4-6-12-8-5-9-15-14(12)13/h4,6-7,11,15-16H,3,5,8-10H2,1-2H3 |
| InChIKey | ABWMRANKTRZRAW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |