C14H22N2O — CID 80650133
4-(1,2,3,4-tetrahydroquinolin-8-ylmethylamino)butan-2-ol (PubChem CID 80650133) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 4-(1,2,3,4-tetrahydroquinolin-8-ylmethylamino)butan-2-ol.
| Compound Name | 4-(1,2,3,4-tetrahydroquinolin-8-ylmethylamino)butan-2-ol |
|---|---|
| PubChem CID | 80650133 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 4-(1,2,3,4-tetrahydroquinolin-8-ylmethylamino)butan-2-ol |
| SMILES | CC(O)CCNCc1cccc2c1NCCC2 |
| InChI | InChI=1S/C14H22N2O/c1-11(17)7-9-15-10-13-5-2-4-12-6-3-8-16-14(12)13/h2,4-5,11,15-17H,3,6-10H2,1H3 |
| InChIKey | QOBGLRGSWRGUIK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|