C18H22N2O — CID 80648722
2-phenoxy-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)ethanamine (PubChem CID 80648722) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-phenoxy-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)ethanamine.
| Compound Name | 2-phenoxy-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 80648722 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-phenoxy-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)ethanamine |
| SMILES | c1ccc(OCCNCc2cccc3c2NCCC3)cc1 |
| InChI | InChI=1S/C18H22N2O/c1-2-9-17(10-3-1)21-13-12-19-14-16-7-4-6-15-8-5-11-20-18(15)16/h1-4,6-7,9-10,19-20H,5,8,11-14H2 |
| InChIKey | KWQCAMYAMIXJJH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|