C14H18N2 — CID 80649535
N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)but-3-yn-1-amine (PubChem CID 80649535) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)but-3-yn-1-amine.
| Compound Name | N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)but-3-yn-1-amine |
|---|---|
| PubChem CID | 80649535 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)but-3-yn-1-amine |
| SMILES | C#CCCNCc1cccc2c1NCCC2 |
| InChI | InChI=1S/C14H18N2/c1-2-3-9-15-11-13-7-4-6-12-8-5-10-16-14(12)13/h1,4,6-7,15-16H,3,5,8-11H2 |
| InChIKey | UEVSYDATUFNJAP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|