C14H23N3 — CID 80649186
N'-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)butane-1,4-diamine (PubChem CID 80649186) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is N'-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)butane-1,4-diamine.
| Compound Name | N'-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 80649186 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | N'-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)butane-1,4-diamine |
| SMILES | NCCCCNCc1cccc2c1NCCC2 |
| InChI | InChI=1S/C14H23N3/c15-8-1-2-9-16-11-13-6-3-5-12-7-4-10-17-14(12)13/h3,5-6,16-17H,1-2,4,7-11,15H2 |
| InChIKey | LGQANGJQNDXZBE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|