C13H20N2O — CID 106840914
4-(2,3-dihydro-1H-indol-7-ylmethylamino)butan-1-ol (PubChem CID 106840914) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-indol-7-ylmethylamino)butan-1-ol.
| Compound Name | 4-(2,3-dihydro-1H-indol-7-ylmethylamino)butan-1-ol |
|---|---|
| PubChem CID | 106840914 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 4-(2,3-dihydro-1H-indol-7-ylmethylamino)butan-1-ol |
| SMILES | OCCCCNCc1cccc2c1NCC2 |
| InChI | InChI=1S/C13H20N2O/c16-9-2-1-7-14-10-12-5-3-4-11-6-8-15-13(11)12/h3-5,14-16H,1-2,6-10H2 |
| InChIKey | JTAUANOIGKJRDE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|