C13H20N2S — CID 80650038
N-(2,3-dihydro-1H-indol-7-ylmethyl)-3-methylsulfanylpropan-1-amine (PubChem CID 80650038) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-7-ylmethyl)-3-methylsulfanylpropan-1-amine.
| Compound Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 80650038 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-3-methylsulfanylpropan-1-amine |
| SMILES | CSCCCNCc1cccc2c1NCC2 |
| InChI | InChI=1S/C13H20N2S/c1-16-9-3-7-14-10-12-5-2-4-11-6-8-15-13(11)12/h2,4-5,14-15H,3,6-10H2,1H3 |
| InChIKey | AODBRLBXLRPBFF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|