C16H18N2 — CID 80649878
N-(2,3-dihydro-1H-indol-7-ylmethyl)-1-phenylmethanamine (PubChem CID 80649878) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-7-ylmethyl)-1-phenylmethanamine.
| Compound Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-1-phenylmethanamine |
|---|---|
| PubChem CID | 80649878 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-1-phenylmethanamine |
| SMILES | c1ccc(CNCc2cccc3c2NCC3)cc1 |
| InChI | InChI=1S/C16H18N2/c1-2-5-13(6-3-1)11-17-12-15-8-4-7-14-9-10-18-16(14)15/h1-8,17-18H,9-12H2 |
| InChIKey | RLLXJUOVALGSNA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |