C18H22N2 — CID 125424059
N-benzyl-2-(1,2,3,4-tetrahydroquinolin-8-yl)ethanamine (PubChem CID 125424059) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is N-benzyl-2-(1,2,3,4-tetrahydroquinolin-8-yl)ethanamine.
| Compound Name | N-benzyl-2-(1,2,3,4-tetrahydroquinolin-8-yl)ethanamine |
|---|---|
| PubChem CID | 125424059 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N-benzyl-2-(1,2,3,4-tetrahydroquinolin-8-yl)ethanamine |
| SMILES | c1ccc(CNCCc2cccc3c2NCCC3)cc1 |
| InChI | InChI=1S/C18H22N2/c1-2-6-15(7-3-1)14-19-13-11-17-9-4-8-16-10-5-12-20-18(16)17/h1-4,6-9,19-20H,5,10-14H2 |
| InChIKey | XXFQAUAOAZAZLA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|