C15H23N3O — CID 81423411
1-propan-2-yl-3-[2-(1,2,3,4-tetrahydroquinolin-8-yl)ethyl]urea (PubChem CID 81423411) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-propan-2-yl-3-[2-(1,2,3,4-tetrahydroquinolin-8-yl)ethyl]urea.
| Compound Name | 1-propan-2-yl-3-[2-(1,2,3,4-tetrahydroquinolin-8-yl)ethyl]urea |
|---|---|
| PubChem CID | 81423411 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 1-propan-2-yl-3-[2-(1,2,3,4-tetrahydroquinolin-8-yl)ethyl]urea |
| SMILES | CC(C)NC(=O)NCCc1cccc2c1NCCC2 |
| InChI | InChI=1S/C15H23N3O/c1-11(2)18-15(19)17-10-8-13-6-3-5-12-7-4-9-16-14(12)13/h3,5-6,11,16H,4,7-10H2,1-2H3,(H2,17,18,19) |
| InChIKey | CXLPAFADZAMWAW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |