C13H20N2 — CID 80648504
N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)propan-2-amine (PubChem CID 80648504) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)propan-2-amine.
| Compound Name | N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 80648504 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)propan-2-amine |
| SMILES | CC(C)NCc1cccc2c1NCCC2 |
| InChI | InChI=1S/C13H20N2/c1-10(2)15-9-12-6-3-5-11-7-4-8-14-13(11)12/h3,5-6,10,14-15H,4,7-9H2,1-2H3 |
| InChIKey | XMKXIXXAGXXYOI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |