C18H21ClN2 — CID 80648824
2-(4-chlorophenyl)-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)ethanamine (PubChem CID 80648824) has the molecular formula C18H21ClN2 and a molecular weight of 300.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)ethanamine.
| Compound Name | 2-(4-chlorophenyl)-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 80648824 |
| Molecular Formula | C18H21ClN2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)ethanamine |
| SMILES | Clc1ccc(CCNCc2cccc3c2NCCC3)cc1 |
| InChI | InChI=1S/C18H21ClN2/c19-17-8-6-14(7-9-17)10-12-20-13-16-4-1-3-15-5-2-11-21-18(15)16/h1,3-4,6-9,20-21H,2,5,10-13H2 |
| InChIKey | CYGQHDJANSFBHO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|