C19H24N2 — CID 80649779
4-propyl-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)aniline (PubChem CID 80649779) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 4-propyl-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)aniline.
| Compound Name | 4-propyl-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)aniline |
|---|---|
| PubChem CID | 80649779 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 4-propyl-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)aniline |
| SMILES | CCCc1ccc(NCc2cccc3c2NCCC3)cc1 |
| InChI | InChI=1S/C19H24N2/c1-2-5-15-9-11-18(12-10-15)21-14-17-7-3-6-16-8-4-13-20-19(16)17/h3,6-7,9-12,20-21H,2,4-5,8,13-14H2,1H3 |
| InChIKey | MUSWZZXGXBWDHM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |