C16H16F2N2 — CID 80649508
2,3-difluoro-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)aniline (PubChem CID 80649508) has the molecular formula C16H16F2N2 and a molecular weight of 274.31 g/mol. Its IUPAC name is 2,3-difluoro-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)aniline.
| Compound Name | 2,3-difluoro-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)aniline |
|---|---|
| PubChem CID | 80649508 |
| Molecular Formula | C16H16F2N2 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2,3-difluoro-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)aniline |
| SMILES | Fc1cccc(NCc2cccc3c2NCCC3)c1F |
| InChI | InChI=1S/C16H16F2N2/c17-13-7-2-8-14(15(13)18)20-10-12-5-1-4-11-6-3-9-19-16(11)12/h1-2,4-5,7-8,19-20H,3,6,9-10H2 |
| InChIKey | RXRSKVCQPIYMNQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |